C21H30FN3O2 — CID 42095215
N-(3-cyclopentylpropyl)-2-[(2S)-1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 42095215) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-2-[(2S)-1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(3-cyclopentylpropyl)-2-[(2S)-1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 42095215 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-(3-cyclopentylpropyl)-2-[(2S)-1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1C(=O)NCCN1Cc1ccc(F)cc1)NCCCC1CCCC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-18-9-7-17(8-10-18)15-25-13-12-24-21(27)19(25)14-20(26)23-11-3-6-16-4-1-2-5-16/h7-10,16,19H,1-6,11-15H2,(H,23,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | MFEDWDCFUVGDIC-IBGZPJMESA-N |
| XLogP | 2.60 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|