C21H30FN3O2 — CID 24819460
N-cyclooctyl-2-[1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 24819460) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is N-cyclooctyl-2-[1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-cyclooctyl-2-[1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 24819460 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-cyclooctyl-2-[1-[(4-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1ccc(F)cc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-17-10-8-16(9-11-17)15-25-13-12-23-21(27)19(25)14-20(26)24-18-6-4-2-1-3-5-7-18/h8-11,18-19H,1-7,12-15H2,(H,23,27)(H,24,26) |
| InChIKey | VLKYZZXNZIYMOZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |