C17H21ClFN3O2 — CID 42594440
2-[(2R)-1-[(4-chloro-3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cyclobutylacetamide (PubChem CID 42594440) has the molecular formula C17H21ClFN3O2 and a molecular weight of 353.83 g/mol. Its IUPAC name is 2-[(2R)-1-[(4-chloro-3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cyclobutylacetamide.
| Compound Name | 2-[(2R)-1-[(4-chloro-3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cyclobutylacetamide |
|---|---|
| PubChem CID | 42594440 |
| Molecular Formula | C17H21ClFN3O2 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[(2R)-1-[(4-chloro-3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cyclobutylacetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1Cc1ccc(Cl)c(F)c1)NC1CCC1 |
| InChI | InChI=1S/C17H21ClFN3O2/c18-13-5-4-11(8-14(13)19)10-22-7-6-20-17(24)15(22)9-16(23)21-12-2-1-3-12/h4-5,8,12,15H,1-3,6-7,9-10H2,(H,20,24)(H,21,23)/t15-/m1/s1 |
| InChIKey | VNMJFRKPVMRDOL-OAHLLOKOSA-N |
| XLogP | 1.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |