C20H27ClFN3O2 — CID 42381747
2-[(2R)-1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cycloheptylacetamide (PubChem CID 42381747) has the molecular formula C20H27ClFN3O2 and a molecular weight of 395.91 g/mol. Its IUPAC name is 2-[(2R)-1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cycloheptylacetamide.
| Compound Name | 2-[(2R)-1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 42381747 |
| Molecular Formula | C20H27ClFN3O2 |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 2-[(2R)-1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-cycloheptylacetamide |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1Cc1c(F)cccc1Cl)NC1CCCCCC1 |
| InChI | InChI=1S/C20H27ClFN3O2/c21-16-8-5-9-17(22)15(16)13-25-11-10-23-20(27)18(25)12-19(26)24-14-6-3-1-2-4-7-14/h5,8-9,14,18H,1-4,6-7,10-13H2,(H,23,27)(H,24,26)/t18-/m1/s1 |
| InChIKey | UEIREUUDIXYNPT-GOSISDBHSA-N |
| XLogP | 3.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |