C17H23ClFN3O2S — CID 45192706
2-[1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-methylsulfanylpropyl)acetamide (PubChem CID 45192706) has the molecular formula C17H23ClFN3O2S and a molecular weight of 387.91 g/mol. Its IUPAC name is 2-[1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-methylsulfanylpropyl)acetamide.
| Compound Name | 2-[1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-methylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 45192706 |
| Molecular Formula | C17H23ClFN3O2S |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[1-[(2-chloro-6-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-methylsulfanylpropyl)acetamide |
| SMILES | CSCCCNC(=O)CC1C(=O)NCCN1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H23ClFN3O2S/c1-25-9-3-6-20-16(23)10-15-17(24)21-7-8-22(15)11-12-13(18)4-2-5-14(12)19/h2,4-5,15H,3,6-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | ITSJHXGRUPHQGH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|