C13H16Cl2N4O2 — CID 2806020
2-[1-[(2,6-dichlorophenyl)methyl]-3-oxopiperazin-2-yl]acetohydrazide (PubChem CID 2806020) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[1-[(2,6-dichlorophenyl)methyl]-3-oxopiperazin-2-yl]acetohydrazide.
| Compound Name | 2-[1-[(2,6-dichlorophenyl)methyl]-3-oxopiperazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 2806020 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[1-[(2,6-dichlorophenyl)methyl]-3-oxopiperazin-2-yl]acetohydrazide |
| SMILES | NNC(=O)CC1C(=O)NCCN1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2N4O2/c14-9-2-1-3-10(15)8(9)7-19-5-4-17-13(21)11(19)6-12(20)18-16/h1-3,11H,4-7,16H2,(H,17,21)(H,18,20) |
| InChIKey | FBINGSWHPOHGSZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|