C19H30N4O4 — CID 54847576
2-[1-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide (PubChem CID 54847576) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-[1-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide.
| Compound Name | 2-[1-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 54847576 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[1-[[3-methoxy-2-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide |
| SMILES | COc1cccc(CN2CCNC(=O)C2CC(=O)NN)c1OCCC(C)C |
| InChI | InChI=1S/C19H30N4O4/c1-13(2)7-10-27-18-14(5-4-6-16(18)26-3)12-23-9-8-21-19(25)15(23)11-17(24)22-20/h4-6,13,15H,7-12,20H2,1-3H3,(H,21,25)(H,22,24) |
| InChIKey | YYZAKJPIPNGVPL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|