C22H28N4O5 — CID 42394628
2-[(2R)-1-[(2,3-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide (PubChem CID 42394628) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-[(2R)-1-[(2,3-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide.
| Compound Name | 2-[(2R)-1-[(2,3-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 42394628 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[(2R)-1-[(2,3-dimethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
| SMILES | COc1cccc(CN2CCNC(=O)[C@H]2CC(=O)NCCOc2cccnc2)c1OC |
| InChI | InChI=1S/C22H28N4O5/c1-29-19-7-3-5-16(21(19)30-2)15-26-11-9-25-22(28)18(26)13-20(27)24-10-12-31-17-6-4-8-23-14-17/h3-8,14,18H,9-13,15H2,1-2H3,(H,24,27)(H,25,28)/t18-/m1/s1 |
| InChIKey | CFCJAHOIBHAOKV-GOSISDBHSA-N |
| XLogP | 0.98 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|