C17H26N4O3 — CID 26395842
2-[(2R)-1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide (PubChem CID 26395842) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(2R)-1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide.
| Compound Name | 2-[(2R)-1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 26395842 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-[(2R)-1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-(2-pyridin-3-yloxyethyl)acetamide |
| SMILES | CC(C)CN1CCNC(=O)[C@H]1CC(=O)NCCOc1cccnc1 |
| InChI | InChI=1S/C17H26N4O3/c1-13(2)12-21-8-6-20-17(23)15(21)10-16(22)19-7-9-24-14-4-3-5-18-11-14/h3-5,11,13,15H,6-10,12H2,1-2H3,(H,19,22)(H,20,23)/t15-/m1/s1 |
| InChIKey | VSRADTYCOXZPBT-OAHLLOKOSA-N |
| XLogP | 0.42 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|