C21H26N4O3 — CID 45233956
2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 45233956) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 45233956 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CCOc1ccc(CN2CCNC(=O)C2CC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-28-18-7-5-16(6-8-18)15-25-11-10-23-21(27)19(25)12-20(26)24-14-17-4-3-9-22-13-17/h3-9,13,19H,2,10-12,14-15H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | ORBZPFRARSMPAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |