C25H30N4O3 — CID 45249434
2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 45249434) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 45249434 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 2-[1-[(4-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CCOc1ccc(CN2CCNC(=O)C2CC(=O)NCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H30N4O3/c1-2-32-20-9-7-18(8-10-20)17-29-14-13-27-25(31)23(29)15-24(30)26-12-11-19-16-28-22-6-4-3-5-21(19)22/h3-10,16,23,28H,2,11-15,17H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | DQQGZXMLCSGLBA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |