C18H29N5O2 — CID 56901393
2-[1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide (PubChem CID 56901393) has the molecular formula C18H29N5O2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-[1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 56901393 |
| Molecular Formula | C18H29N5O2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-[1-(2-methylpropyl)-3-oxopiperazin-2-yl]-N-[2-[(3-methyl-2-pyridinyl)amino]ethyl]acetamide |
| SMILES | Cc1cccnc1NCCNC(=O)CC1C(=O)NCCN1CC(C)C |
| InChI | InChI=1S/C18H29N5O2/c1-13(2)12-23-10-9-22-18(25)15(23)11-16(24)19-7-8-21-17-14(3)5-4-6-20-17/h4-6,13,15H,7-12H2,1-3H3,(H,19,24)(H,20,21)(H,22,25) |
| InChIKey | MTUCYEXONFJDJP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|