C19H29N3O4 — CID 95721705
2-[(2R)-1-[(4-methoxy-2,3-dimethylphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 95721705) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-[(2R)-1-[(4-methoxy-2,3-dimethylphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R)-1-[(4-methoxy-2,3-dimethylphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 95721705 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[(2R)-1-[(4-methoxy-2,3-dimethylphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1C(=O)NCCN1Cc1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C19H29N3O4/c1-13-14(2)17(26-4)6-5-15(13)12-22-9-7-21-19(24)16(22)11-18(23)20-8-10-25-3/h5-6,16H,7-12H2,1-4H3,(H,20,23)(H,21,24)/t16-/m1/s1 |
| InChIKey | KLFUWODGXBNTBO-MRXNPFEDSA-N |
| XLogP | 0.77 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|