C16H22FN3O4 — CID 56899622
2-[1-[(2-fluoro-4-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 56899622) has the molecular formula C16H22FN3O4 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[1-[(2-fluoro-4-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | 2-[1-[(2-fluoro-4-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 56899622 |
| Molecular Formula | C16H22FN3O4 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[1-[(2-fluoro-4-methoxyphenyl)methyl]-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | COc1ccc(CN2CCNC(=O)C2CC(=O)NCCO)c(F)c1 |
| InChI | InChI=1S/C16H22FN3O4/c1-24-12-3-2-11(13(17)8-12)10-20-6-4-19-16(23)14(20)9-15(22)18-5-7-21/h2-3,8,14,21H,4-7,9-10H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | IZLVCVRPOUOIHS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |