C17H23FN4O3 — CID 56903638
N-(2-acetamidoethyl)-2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 56903638) has the molecular formula C17H23FN4O3 and a molecular weight of 350.39 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 56903638 |
| Molecular Formula | C17H23FN4O3 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)CC1C(=O)NCCN1Cc1ccccc1F |
| InChI | InChI=1S/C17H23FN4O3/c1-12(23)19-6-7-20-16(24)10-15-17(25)21-8-9-22(15)11-13-4-2-3-5-14(13)18/h2-5,15H,6-11H2,1H3,(H,19,23)(H,20,24)(H,21,25) |
| InChIKey | MJCJWTCGZITGPA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|