C17H22FN3O4 — CID 45242481
methyl 2-[[2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]-methylamino]acetate (PubChem CID 45242481) has the molecular formula C17H22FN3O4 and a molecular weight of 351.38 g/mol. Its IUPAC name is methyl 2-[[2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]-methylamino]acetate.
| Compound Name | methyl 2-[[2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]-methylamino]acetate |
|---|---|
| PubChem CID | 45242481 |
| Molecular Formula | C17H22FN3O4 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | methyl 2-[[2-[1-[(2-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]-methylamino]acetate |
| SMILES | COC(=O)CN(C)C(=O)CC1C(=O)NCCN1Cc1ccccc1F |
| InChI | InChI=1S/C17H22FN3O4/c1-20(11-16(23)25-2)15(22)9-14-17(24)19-7-8-21(14)10-12-5-3-4-6-13(12)18/h3-6,14H,7-11H2,1-2H3,(H,19,24) |
| InChIKey | XGTNFCQHMWIPMJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |