C19H27F2N3O3 — CID 42193728
2-[(2S)-1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 42193728) has the molecular formula C19H27F2N3O3 and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-[(2S)-1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[(2S)-1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 42193728 |
| Molecular Formula | C19H27F2N3O3 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[(2S)-1-[(2,3-difluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)C[C@H]1C(=O)NCCN1Cc1cccc(F)c1F |
| InChI | InChI=1S/C19H27F2N3O3/c1-13(2)27-10-4-7-22-17(25)11-16-19(26)23-8-9-24(16)12-14-5-3-6-15(20)18(14)21/h3,5-6,13,16H,4,7-12H2,1-2H3,(H,22,25)(H,23,26)/t16-/m0/s1 |
| InChIKey | HAGMJDABTLYMIR-INIZCTEOSA-N |
| XLogP | 1.59 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|