C18H28N4O3 — CID 54847910
2-[1-[[3-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide (PubChem CID 54847910) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[1-[[3-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide.
| Compound Name | 2-[1-[[3-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 54847910 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-[1-[[3-(3-methylbutoxy)phenyl]methyl]-3-oxopiperazin-2-yl]acetohydrazide |
| SMILES | CC(C)CCOc1cccc(CN2CCNC(=O)C2CC(=O)NN)c1 |
| InChI | InChI=1S/C18H28N4O3/c1-13(2)6-9-25-15-5-3-4-14(10-15)12-22-8-7-20-18(24)16(22)11-17(23)21-19/h3-5,10,13,16H,6-9,11-12,19H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | RMQQYZDHPJDKEE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|