C19H28N2O5 — CID 54848518
2-[1-[(3-methoxy-2-pentoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 54848518) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[1-[(3-methoxy-2-pentoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[(3-methoxy-2-pentoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54848518 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[1-[(3-methoxy-2-pentoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | CCCCCOc1c(CN2CCNC(=O)C2CC(=O)O)cccc1OC |
| InChI | InChI=1S/C19H28N2O5/c1-3-4-5-11-26-18-14(7-6-8-16(18)25-2)13-21-10-9-20-19(24)15(21)12-17(22)23/h6-8,15H,3-5,9-13H2,1-2H3,(H,20,24)(H,22,23) |
| InChIKey | VMZNRLCUSGIBRF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|