C20H30N2O4 — CID 54848182
2-[1-[(2-heptoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 54848182) has the molecular formula C20H30N2O4 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-[1-[(2-heptoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[(2-heptoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 54848182 |
| Molecular Formula | C20H30N2O4 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 2-[1-[(2-heptoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | CCCCCCCOc1ccccc1CN1CCNC(=O)C1CC(=O)O |
| InChI | InChI=1S/C20H30N2O4/c1-2-3-4-5-8-13-26-18-10-7-6-9-16(18)15-22-12-11-21-20(25)17(22)14-19(23)24/h6-7,9-10,17H,2-5,8,11-15H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | RLDWPRWVUWNRCQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|