C19H26N4O4 — CID 95722194
(3R)-4-[(2-ethoxyphenyl)methyl]-3-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 95722194) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (3R)-4-[(2-ethoxyphenyl)methyl]-3-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | (3R)-4-[(2-ethoxyphenyl)methyl]-3-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 95722194 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (3R)-4-[(2-ethoxyphenyl)methyl]-3-[2-oxo-2-(3-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CCOc1ccccc1CN1CCNC(=O)[C@H]1CC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C19H26N4O4/c1-2-27-16-6-4-3-5-14(16)12-22-9-8-21-19(26)15(22)11-18(25)23-10-7-20-17(24)13-23/h3-6,15H,2,7-13H2,1H3,(H,20,24)(H,21,26)/t15-/m1/s1 |
| InChIKey | RMBGQBTWCZOBPA-OAHLLOKOSA-N |
| XLogP | -0.27 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |