C17H24N4O4 — CID 56906729
N-(2-amino-2-oxoethyl)-2-[1-[(2-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 56906729) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-[1-[(2-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-[1-[(2-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 56906729 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-[1-[(2-ethoxyphenyl)methyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | CCOc1ccccc1CN1CCNC(=O)C1CC(=O)NCC(N)=O |
| InChI | InChI=1S/C17H24N4O4/c1-2-25-14-6-4-3-5-12(14)11-21-8-7-19-17(24)13(21)9-16(23)20-10-15(18)22/h3-6,13H,2,7-11H2,1H3,(H2,18,22)(H,19,24)(H,20,23) |
| InChIKey | AEXSRZZMJILHSJ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |