C23H28N4O2 — CID 45243840
2-[3-oxo-1-[(E)-3-phenylprop-2-enyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide (PubChem CID 45243840) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-[3-oxo-1-[(E)-3-phenylprop-2-enyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide.
| Compound Name | 2-[3-oxo-1-[(E)-3-phenylprop-2-enyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide |
|---|---|
| PubChem CID | 45243840 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-[3-oxo-1-[(E)-3-phenylprop-2-enyl]piperazin-2-yl]-N-(3-pyridin-3-ylpropyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1C/C=C/c1ccccc1)NCCCc1cccnc1 |
| InChI | InChI=1S/C23H28N4O2/c28-22(25-13-5-10-20-9-4-12-24-18-20)17-21-23(29)26-14-16-27(21)15-6-11-19-7-2-1-3-8-19/h1-4,6-9,11-12,18,21H,5,10,13-17H2,(H,25,28)(H,26,29)/b11-6+ |
| InChIKey | IOOMRHDVKBRHAE-IZZDOVSWSA-N |
| XLogP | 2.03 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|