C25H31N3O3 — CID 42189085
2-[(2R)-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-oxopiperazin-2-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 42189085) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-[(2R)-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-oxopiperazin-2-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(2R)-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-oxopiperazin-2-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 42189085 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[(2R)-1-[(E)-3-(2-methoxyphenyl)prop-2-enyl]-3-oxopiperazin-2-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | COc1ccccc1/C=C/CN1CCNC(=O)[C@H]1CC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C25H31N3O3/c1-31-23-14-6-5-12-21(23)13-8-17-28-18-16-27-25(30)22(28)19-24(29)26-15-7-11-20-9-3-2-4-10-20/h2-6,8-10,12-14,22H,7,11,15-19H2,1H3,(H,26,29)(H,27,30)/b13-8+/t22-/m1/s1 |
| InChIKey | DHDQVUCVCGTWOJ-MKGTUJQCSA-N |
| XLogP | 2.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|