C24H25N5O3 — CID 45228056
2-[3-oxo-1-[(3-phenoxyphenyl)methyl]piperazin-2-yl]-N-(pyrimidin-4-ylmethyl)acetamide (PubChem CID 45228056) has the molecular formula C24H25N5O3 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-[3-oxo-1-[(3-phenoxyphenyl)methyl]piperazin-2-yl]-N-(pyrimidin-4-ylmethyl)acetamide.
| Compound Name | 2-[3-oxo-1-[(3-phenoxyphenyl)methyl]piperazin-2-yl]-N-(pyrimidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 45228056 |
| Molecular Formula | C24H25N5O3 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[3-oxo-1-[(3-phenoxyphenyl)methyl]piperazin-2-yl]-N-(pyrimidin-4-ylmethyl)acetamide |
| SMILES | O=C(CC1C(=O)NCCN1Cc1cccc(Oc2ccccc2)c1)NCc1ccncn1 |
| InChI | InChI=1S/C24H25N5O3/c30-23(27-15-19-9-10-25-17-28-19)14-22-24(31)26-11-12-29(22)16-18-5-4-8-21(13-18)32-20-6-2-1-3-7-20/h1-10,13,17,22H,11-12,14-16H2,(H,26,31)(H,27,30) |
| InChIKey | FIUKLJALZZLZPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |