C23H34N4O5 — CID 54823094
butyl 2-[1-[2-[3-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54823094) has the molecular formula C23H34N4O5 and a molecular weight of 446.55 g/mol. Its IUPAC name is butyl 2-[1-[2-[3-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[3-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54823094 |
| Molecular Formula | C23H34N4O5 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | butyl 2-[1-[2-[3-(2,2-dimethylpropanoylamino)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C23H34N4O5/c1-5-6-12-32-20(29)14-18-21(30)24-10-11-27(18)15-19(28)25-16-8-7-9-17(13-16)26-22(31)23(2,3)4/h7-9,13,18H,5-6,10-12,14-15H2,1-4H3,(H,24,30)(H,25,28)(H,26,31) |
| InChIKey | VQEODWSKYVWLHS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|