C27H34N4O5 — CID 54823128
butyl 2-[1-[2-[3-[benzyl(methyl)carbamoyl]anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54823128) has the molecular formula C27H34N4O5 and a molecular weight of 494.59 g/mol. Its IUPAC name is butyl 2-[1-[2-[3-[benzyl(methyl)carbamoyl]anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[3-[benzyl(methyl)carbamoyl]anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54823128 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | butyl 2-[1-[2-[3-[benzyl(methyl)carbamoyl]anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(C(=O)N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H34N4O5/c1-3-4-15-36-25(33)17-23-26(34)28-13-14-31(23)19-24(32)29-22-12-8-11-21(16-22)27(35)30(2)18-20-9-6-5-7-10-20/h5-12,16,23H,3-4,13-15,17-19H2,1-2H3,(H,28,34)(H,29,32) |
| InChIKey | RIGNYCWSBPHQEN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|