C21H31N3O6 — CID 54823089
butyl 2-[1-[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54823089) has the molecular formula C21H31N3O6 and a molecular weight of 421.49 g/mol. Its IUPAC name is butyl 2-[1-[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54823089 |
| Molecular Formula | C21H31N3O6 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | butyl 2-[1-[2-[4-(2-methoxyethoxy)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C21H31N3O6/c1-3-4-11-30-20(26)14-18-21(27)22-9-10-24(18)15-19(25)23-16-5-7-17(8-6-16)29-13-12-28-2/h5-8,18H,3-4,9-15H2,1-2H3,(H,22,27)(H,23,25) |
| InChIKey | GMWGBSBUVQIWIV-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|