C18H23N3O6 — CID 8561303
ethyl 4-[[2-[(2R)-2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]acetyl]amino]benzoate (PubChem CID 8561303) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is ethyl 4-[[2-[(2R)-2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2R)-2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8561303 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | ethyl 4-[[2-[(2R)-2-(2-methoxy-2-oxoethyl)-3-oxopiperazin-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2CCNC(=O)[C@H]2CC(=O)OC)cc1 |
| InChI | InChI=1S/C18H23N3O6/c1-3-27-18(25)12-4-6-13(7-5-12)20-15(22)11-21-9-8-19-17(24)14(21)10-16(23)26-2/h4-7,14H,3,8-11H2,1-2H3,(H,19,24)(H,20,22)/t14-/m1/s1 |
| InChIKey | KTOJZYFXUICSNH-CQSZACIVSA-N |
| XLogP | 0.17 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |