C18H24N4O5 — CID 7126577
ethyl 4-[[2-[(2S)-1-(ethylcarbamoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzoate (PubChem CID 7126577) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is ethyl 4-[[2-[(2S)-1-(ethylcarbamoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(2S)-1-(ethylcarbamoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7126577 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | ethyl 4-[[2-[(2S)-1-(ethylcarbamoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzoate |
| SMILES | CCNC(=O)N1CCNC(=O)[C@@H]1CC(=O)Nc1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H24N4O5/c1-3-19-18(26)22-10-9-20-16(24)14(22)11-15(23)21-13-7-5-12(6-8-13)17(25)27-4-2/h5-8,14H,3-4,9-11H2,1-2H3,(H,19,26)(H,20,24)(H,21,23)/t14-/m0/s1 |
| InChIKey | PRXAMARFTYHWGD-AWEZNQCLSA-N |
| XLogP | 0.72 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |