C15H17ClN4O4 — CID 97182735
4-[[2-[(2R)-1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetyl]amino]benzamide (PubChem CID 97182735) has the molecular formula C15H17ClN4O4 and a molecular weight of 352.78 g/mol. Its IUPAC name is 4-[[2-[(2R)-1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetyl]amino]benzamide.
| Compound Name | 4-[[2-[(2R)-1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 97182735 |
| Molecular Formula | C15H17ClN4O4 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 4-[[2-[(2R)-1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C[C@@H]2C(=O)NCCN2C(=O)CCl)cc1 |
| InChI | InChI=1S/C15H17ClN4O4/c16-8-13(22)20-6-5-18-15(24)11(20)7-12(21)19-10-3-1-9(2-4-10)14(17)23/h1-4,11H,5-8H2,(H2,17,23)(H,18,24)(H,19,21)/t11-/m1/s1 |
| InChIKey | JYRFGTGCTHYULU-LLVKDONJSA-N |
| XLogP | -0.32 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|