C19H24ClN5O4 — CID 29111514
N-(4-chlorophenyl)-2-[(2S)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 29111514) has the molecular formula C19H24ClN5O4 and a molecular weight of 421.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2S)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2S)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 29111514 |
| Molecular Formula | C19H24ClN5O4 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2S)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=CN1CCN(CC(=O)N2CCNC(=O)[C@@H]2CC(=O)Nc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H24ClN5O4/c20-14-1-3-15(4-2-14)22-17(27)11-16-19(29)21-5-6-25(16)18(28)12-23-7-9-24(13-26)10-8-23/h1-4,13,16H,5-12H2,(H,21,29)(H,22,27)/t16-/m0/s1 |
| InChIKey | GBIBEYPJLKDOEX-INIZCTEOSA-N |
| XLogP | -0.23 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|