C21H29N5O4 — CID 16653833
N-(4-ethylphenyl)-2-[1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 16653833) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 16653833 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | N-(4-ethylphenyl)-2-[1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)CC2C(=O)NCCN2C(=O)CN2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O4/c1-2-16-3-5-17(6-4-16)23-19(28)13-18-21(30)22-7-8-26(18)20(29)14-24-9-11-25(15-27)12-10-24/h3-6,15,18H,2,7-14H2,1H3,(H,22,30)(H,23,28) |
| InChIKey | REFBEKGVVSPMBH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|