C21H29N5O6 — CID 30468523
N-(2,5-dimethoxyphenyl)-2-[(2R)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 30468523) has the molecular formula C21H29N5O6 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-[(2R)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-[(2R)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 30468523 |
| Molecular Formula | C21H29N5O6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-[(2R)-1-[2-(4-formylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)C[C@@H]2C(=O)NCCN2C(=O)CN2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C21H29N5O6/c1-31-15-3-4-18(32-2)16(11-15)23-19(28)12-17-21(30)22-5-6-26(17)20(29)13-24-7-9-25(14-27)10-8-24/h3-4,11,14,17H,5-10,12-13H2,1-2H3,(H,22,30)(H,23,28)/t17-/m1/s1 |
| InChIKey | KCWZYTPEGCCNGX-QGZVFWFLSA-N |
| XLogP | -0.87 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|