C26H33N5O5 — CID 30468207
N-(2-methoxyphenyl)-2-[(2R)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-3-oxopiperazin-2-yl]acetamide (PubChem CID 30468207) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[(2R)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-(2-methoxyphenyl)-2-[(2R)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 30468207 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[(2R)-1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]acetyl]-3-oxopiperazin-2-yl]acetamide |
| SMILES | COc1ccc(N2CCN(CC(=O)N3CCNC(=O)[C@H]3CC(=O)Nc3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C26H33N5O5/c1-35-20-9-7-19(8-10-20)30-15-13-29(14-16-30)18-25(33)31-12-11-27-26(34)22(31)17-24(32)28-21-5-3-4-6-23(21)36-2/h3-10,22H,11-18H2,1-2H3,(H,27,34)(H,28,32)/t22-/m1/s1 |
| InChIKey | MEKQRYVFKLJHER-JOCHJYFZSA-N |
| XLogP | 1.18 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|