C26H33N5O3 — CID 16653918
2-[1-[2-(4-benzylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide (PubChem CID 16653918) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[1-[2-(4-benzylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[1-[2-(4-benzylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 16653918 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | 2-[1-[2-(4-benzylpiperazin-1-yl)acetyl]-3-oxopiperazin-2-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CC2C(=O)NCCN2C(=O)CN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H33N5O3/c1-20-7-9-22(10-8-20)28-24(32)17-23-26(34)27-11-12-31(23)25(33)19-30-15-13-29(14-16-30)18-21-5-3-2-4-6-21/h2-10,23H,11-19H2,1H3,(H,27,34)(H,28,32) |
| InChIKey | HIAUBUNDTOVWDE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |