C15H18IN3O4 — CID 46820582
methyl 2-[1-[2-(3-iodoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 46820582) has the molecular formula C15H18IN3O4 and a molecular weight of 431.23 g/mol. Its IUPAC name is methyl 2-[1-[2-(3-iodoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[2-(3-iodoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 46820582 |
| Molecular Formula | C15H18IN3O4 |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | methyl 2-[1-[2-(3-iodoanilino)-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C15H18IN3O4/c1-23-14(21)8-12-15(22)17-5-6-19(12)9-13(20)18-11-4-2-3-10(16)7-11/h2-4,7,12H,5-6,8-9H2,1H3,(H,17,22)(H,18,20) |
| InChIKey | OETVIZBSDDQPAG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|