C22H32N4O6 — CID 54819699
propyl 2-[1-[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54819699) has the molecular formula C22H32N4O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is propyl 2-[1-[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54819699 |
| Molecular Formula | C22H32N4O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | propyl 2-[1-[2-[3-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1CC(=O)Nc1cccc(C(=O)NCCCOC)c1 |
| InChI | InChI=1S/C22H32N4O6/c1-3-11-32-20(28)14-18-22(30)24-9-10-26(18)15-19(27)25-17-7-4-6-16(13-17)21(29)23-8-5-12-31-2/h4,6-7,13,18H,3,5,8-12,14-15H2,1-2H3,(H,23,29)(H,24,30)(H,25,27) |
| InChIKey | LZSVYMTZPYVQHM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|