C23H34N4O6 — CID 54824922
2-methylpropyl 2-[1-[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54824922) has the molecular formula C23H34N4O6 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-methylpropyl 2-[1-[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-methylpropyl 2-[1-[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54824922 |
| Molecular Formula | C23H34N4O6 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-methylpropyl 2-[1-[2-[4-(3-methoxypropylcarbamoyl)anilino]-2-oxoethyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)CN2CCNC(=O)C2CC(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C23H34N4O6/c1-16(2)15-33-21(29)13-19-23(31)25-10-11-27(19)14-20(28)26-18-7-5-17(6-8-18)22(30)24-9-4-12-32-3/h5-8,16,19H,4,9-15H2,1-3H3,(H,24,30)(H,25,31)(H,26,28) |
| InChIKey | YBHDBOPQQBJCQN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|