C15H19N3O5S — CID 40684007
propyl 2-[(2R)-1-(furan-2-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 40684007) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is propyl 2-[(2R)-1-(furan-2-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[(2R)-1-(furan-2-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 40684007 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | propyl 2-[(2R)-1-(furan-2-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)C[C@@H]1C(=O)NCCN1C(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H19N3O5S/c1-2-7-23-12(19)9-10-13(20)16-5-6-18(10)15(24)17-14(21)11-4-3-8-22-11/h3-4,8,10H,2,5-7,9H2,1H3,(H,16,20)(H,17,21,24)/t10-/m1/s1 |
| InChIKey | NJXGVLQEXWTWEO-SNVBAGLBSA-N |
| XLogP | 0.44 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|