C18H23N3O5S — CID 4959235
butyl 2-[1-[3-(furan-2-yl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4959235) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is butyl 2-[1-[3-(furan-2-yl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[3-(furan-2-yl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959235 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | butyl 2-[1-[3-(furan-2-yl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C=Cc1ccco1 |
| InChI | InChI=1S/C18H23N3O5S/c1-2-3-10-26-16(23)12-14-17(24)19-8-9-21(14)18(27)20-15(22)7-6-13-5-4-11-25-13/h4-7,11,14H,2-3,8-10,12H2,1H3,(H,19,24)(H,20,22,27) |
| InChIKey | YLGKWZXLAMXZJJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|