C17H29N3O4S — CID 9319574
butyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 9319574) has the molecular formula C17H29N3O4S and a molecular weight of 371.50 g/mol. Its IUPAC name is butyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9319574 |
| Molecular Formula | C17H29N3O4S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | butyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCC(=O)NC(=S)N1CCNC(=O)[C@H]1CC(=O)OCCCC |
| InChI | InChI=1S/C17H29N3O4S/c1-3-5-7-8-14(21)19-17(25)20-10-9-18-16(23)13(20)12-15(22)24-11-6-4-2/h13H,3-12H2,1-2H3,(H,18,23)(H,19,21,25)/t13-/m1/s1 |
| InChIKey | NKFKVCSPTVEPJC-CYBMUJFWSA-N |
| XLogP | 1.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|