C18H29N3O5S — CID 9293164
[(2S)-oxolan-2-yl]methyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 9293164) has the molecular formula C18H29N3O5S and a molecular weight of 399.51 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9293164 |
| Molecular Formula | C18H29N3O5S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 2-[(2R)-1-(hexanoylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCC(=O)NC(=S)N1CCNC(=O)[C@H]1CC(=O)OC[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H29N3O5S/c1-2-3-4-7-15(22)20-18(27)21-9-8-19-17(24)14(21)11-16(23)26-12-13-6-5-10-25-13/h13-14H,2-12H2,1H3,(H,19,24)(H,20,22,27)/t13-,14+/m0/s1 |
| InChIKey | SAXUXVDKUMTALB-UONOGXRCSA-N |
| XLogP | 0.88 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|