C22H27N3O5S — CID 6234787
oxolan-2-ylmethyl 2-[1-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 6234787) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[1-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | oxolan-2-ylmethyl 2-[1-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 6234787 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | oxolan-2-ylmethyl 2-[1-[[(E)-3-(4-methylphenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | Cc1ccc(/C=C/C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-15-4-6-16(7-5-15)8-9-19(26)24-22(31)25-11-10-23-21(28)18(25)13-20(27)30-14-17-3-2-12-29-17/h4-9,17-18H,2-3,10-14H2,1H3,(H,23,28)(H,24,26,31)/b9-8+ |
| InChIKey | MKGIUTDFJQQJMY-CMDGGOBGSA-N |
| XLogP | 1.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|