C22H27N3O6S — CID 4941151
oxolan-2-ylmethyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4941151) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | oxolan-2-ylmethyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4941151 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | oxolan-2-ylmethyl 2-[1-[3-(2-methoxyphenyl)prop-2-enoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COc1ccccc1C=CC(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCC1CCCO1 |
| InChI | InChI=1S/C22H27N3O6S/c1-29-18-7-3-2-5-15(18)8-9-19(26)24-22(32)25-11-10-23-21(28)17(25)13-20(27)31-14-16-6-4-12-30-16/h2-3,5,7-9,16-17H,4,6,10-14H2,1H3,(H,23,28)(H,24,26,32) |
| InChIKey | CHNWTYQBTCDSAK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|