C21H27Cl2N3O5S — CID 4959227
butyl 2-[1-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4959227) has the molecular formula C21H27Cl2N3O5S and a molecular weight of 504.44 g/mol. Its IUPAC name is butyl 2-[1-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959227 |
| Molecular Formula | C21H27Cl2N3O5S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | butyl 2-[1-[4-(2,4-dichlorophenoxy)butanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H27Cl2N3O5S/c1-2-3-10-31-19(28)13-16-20(29)24-8-9-26(16)21(32)25-18(27)5-4-11-30-17-7-6-14(22)12-15(17)23/h6-7,12,16H,2-5,8-11,13H2,1H3,(H,24,29)(H,25,27,32) |
| InChIKey | DQYUOEQODNFMFY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|