C18H21Cl2N3O4S — CID 4959208
butyl 2-[1-[(2,4-dichlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4959208) has the molecular formula C18H21Cl2N3O4S and a molecular weight of 446.36 g/mol. Its IUPAC name is butyl 2-[1-[(2,4-dichlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[(2,4-dichlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959208 |
| Molecular Formula | C18H21Cl2N3O4S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | butyl 2-[1-[(2,4-dichlorobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H21Cl2N3O4S/c1-2-3-8-27-15(24)10-14-17(26)21-6-7-23(14)18(28)22-16(25)12-5-4-11(19)9-13(12)20/h4-5,9,14H,2-3,6-8,10H2,1H3,(H,21,26)(H,22,25,28) |
| InChIKey | SMFLQBPYPPTZLU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|