C18H22Cl2N2O4 — CID 17073637
pentyl 2-[1-(2,4-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17073637) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is pentyl 2-[1-(2,4-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | pentyl 2-[1-(2,4-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17073637 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | pentyl 2-[1-(2,4-dichlorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O4/c1-2-3-4-9-26-16(23)11-15-17(24)21-7-8-22(15)18(25)13-6-5-12(19)10-14(13)20/h5-6,10,15H,2-4,7-9,11H2,1H3,(H,21,24) |
| InChIKey | QAWPJWUACKTWBH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|