C17H21FN2O4 — CID 4959194
butyl 2-[1-(2-fluorobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4959194) has the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. Its IUPAC name is butyl 2-[1-(2-fluorobenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-(2-fluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959194 |
| Molecular Formula | C17H21FN2O4 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | butyl 2-[1-(2-fluorobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccccc1F |
| InChI | InChI=1S/C17H21FN2O4/c1-2-3-10-24-15(21)11-14-16(22)19-8-9-20(14)17(23)12-6-4-5-7-13(12)18/h4-7,14H,2-3,8-11H2,1H3,(H,19,22) |
| InChIKey | KWYYEHJPFXWURG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|