C23H26N2O4 — CID 9298063
butyl 2-[(2S)-3-oxo-1-(4-phenylbenzoyl)piperazin-2-yl]acetate (PubChem CID 9298063) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is butyl 2-[(2S)-3-oxo-1-(4-phenylbenzoyl)piperazin-2-yl]acetate.
| Compound Name | butyl 2-[(2S)-3-oxo-1-(4-phenylbenzoyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9298063 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | butyl 2-[(2S)-3-oxo-1-(4-phenylbenzoyl)piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)C[C@H]1C(=O)NCCN1C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O4/c1-2-3-15-29-21(26)16-20-22(27)24-13-14-25(20)23(28)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-12,20H,2-3,13-16H2,1H3,(H,24,27)/t20-/m0/s1 |
| InChIKey | NUARVVSKJZNRHJ-FQEVSTJZSA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|